C17H19N4O+ — CID 90894557
N-cyclobutyl-N-(3-methoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine (PubChem CID 90894557) has the molecular formula C17H19N4O+ and a molecular weight of 295.37 g/mol. Its IUPAC name is N-cyclobutyl-N-(3-methoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine.
| Compound Name | N-cyclobutyl-N-(3-methoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine |
|---|---|
| PubChem CID | 90894557 |
| Molecular Formula | C17H19N4O+ |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | N-cyclobutyl-N-(3-methoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine |
| SMILES | COc1cccc(N(C2CCC2)[N+]23C=CN=CC2=CN=C3)c1 |
| InChI | InChI=1S/C17H19N4O/c1-22-17-7-3-6-15(10-17)20(14-4-2-5-14)21-9-8-18-11-16(21)12-19-13-21/h3,6-14H,2,4-5H2,1H3/q+1 |
| InChIKey | ZFTDGBQLZSKWCC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|