C29H35N6O+ — CID 123318326
N-[3-[(4-methylpiperazin-1-yl)methyl]cyclobutyl]-N-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine (PubChem CID 123318326) has the molecular formula C29H35N6O+ and a molecular weight of 483.64 g/mol. Its IUPAC name is N-[3-[(4-methylpiperazin-1-yl)methyl]cyclobutyl]-N-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine.
| Compound Name | N-[3-[(4-methylpiperazin-1-yl)methyl]cyclobutyl]-N-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine |
|---|---|
| PubChem CID | 123318326 |
| Molecular Formula | C29H35N6O+ |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.29 |
| IUPAC Name | N-[3-[(4-methylpiperazin-1-yl)methyl]cyclobutyl]-N-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine |
| SMILES | CN1CCN(CC2CC(N(c3cccc(OCc4ccccc4)c3)[N+]34C=CN=CC3=CN=C4)C2)CC1 |
| InChI | InChI=1S/C29H35N6O/c1-32-11-13-33(14-12-32)21-25-16-27(17-25)34(35-15-10-30-19-28(35)20-31-23-35)26-8-5-9-29(18-26)36-22-24-6-3-2-4-7-24/h2-10,15,18-20,23,25,27H,11-14,16-17,21-22H2,1H3/q+1 |
| InChIKey | CPUIKGHVMAMKLX-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 43.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|