C31H32N5O+ — CID 91515866
N-[1-[(benzylamino)methyl]cyclobutyl]-N-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine (PubChem CID 91515866) has the molecular formula C31H32N5O+ and a molecular weight of 490.63 g/mol. Its IUPAC name is N-[1-[(benzylamino)methyl]cyclobutyl]-N-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine.
| Compound Name | N-[1-[(benzylamino)methyl]cyclobutyl]-N-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine |
|---|---|
| PubChem CID | 91515866 |
| Molecular Formula | C31H32N5O+ |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | N-[1-[(benzylamino)methyl]cyclobutyl]-N-(3-phenylmethoxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine |
| SMILES | C1=C[N+]2(N(c3cccc(OCc4ccccc4)c3)C3(CNCc4ccccc4)CCC3)C=NC=C2C=N1 |
| InChI | InChI=1S/C31H32N5O/c1-3-9-26(10-4-1)20-33-24-31(15-8-16-31)35(36-18-17-32-21-29(36)22-34-25-36)28-13-7-14-30(19-28)37-23-27-11-5-2-6-12-27/h1-7,9-14,17-19,21-22,25,33H,8,15-16,20,23-24H2/q+1 |
| InChIKey | MNNSWHVAGFYWIX-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|