C26H23N4O+ — CID 91600724
N-cyclobutyl-N-(4-naphthalen-2-yloxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine (PubChem CID 91600724) has the molecular formula C26H23N4O+ and a molecular weight of 407.50 g/mol. Its IUPAC name is N-cyclobutyl-N-(4-naphthalen-2-yloxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine.
| Compound Name | N-cyclobutyl-N-(4-naphthalen-2-yloxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine |
|---|---|
| PubChem CID | 91600724 |
| Molecular Formula | C26H23N4O+ |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | N-cyclobutyl-N-(4-naphthalen-2-yloxyphenyl)imidazo[1,5-a]pyrazin-4-ium-4-amine |
| SMILES | C1=C[N+]2(N(c3ccc(Oc4ccc5ccccc5c4)cc3)C3CCC3)C=NC=C2C=N1 |
| InChI | InChI=1S/C26H23N4O/c1-2-5-21-16-26(11-8-20(21)4-1)31-25-12-9-23(10-13-25)29(22-6-3-7-22)30-15-14-27-17-24(30)18-28-19-30/h1-2,4-5,8-19,22H,3,6-7H2/q+1 |
| InChIKey | MNTUMZYEJCTVOU-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|