C23H23N4O2+ — CID 91471356
N-cyclobutyl-N-[4-(2-methoxyphenoxy)phenyl]imidazo[1,5-a]pyrazin-4-ium-4-amine (PubChem CID 91471356) has the molecular formula C23H23N4O2+ and a molecular weight of 387.46 g/mol. Its IUPAC name is N-cyclobutyl-N-[4-(2-methoxyphenoxy)phenyl]imidazo[1,5-a]pyrazin-4-ium-4-amine.
| Compound Name | N-cyclobutyl-N-[4-(2-methoxyphenoxy)phenyl]imidazo[1,5-a]pyrazin-4-ium-4-amine |
|---|---|
| PubChem CID | 91471356 |
| Molecular Formula | C23H23N4O2+ |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | N-cyclobutyl-N-[4-(2-methoxyphenoxy)phenyl]imidazo[1,5-a]pyrazin-4-ium-4-amine |
| SMILES | COc1ccccc1Oc1ccc(N(C2CCC2)[N+]23C=CN=CC2=CN=C3)cc1 |
| InChI | InChI=1S/C23H23N4O2/c1-28-22-7-2-3-8-23(22)29-21-11-9-19(10-12-21)26(18-5-4-6-18)27-14-13-24-15-20(27)16-25-17-27/h2-3,7-18H,4-6H2,1H3/q+1 |
| InChIKey | JHUQFOHKASQYNZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|