C22H20FN4O+ — CID 91409757
N-cyclobutyl-N-[4-(2-fluorophenoxy)phenyl]imidazo[1,5-a]pyrazin-4-ium-4-amine (PubChem CID 91409757) has the molecular formula C22H20FN4O+ and a molecular weight of 375.43 g/mol. Its IUPAC name is N-cyclobutyl-N-[4-(2-fluorophenoxy)phenyl]imidazo[1,5-a]pyrazin-4-ium-4-amine.
| Compound Name | N-cyclobutyl-N-[4-(2-fluorophenoxy)phenyl]imidazo[1,5-a]pyrazin-4-ium-4-amine |
|---|---|
| PubChem CID | 91409757 |
| Molecular Formula | C22H20FN4O+ |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-cyclobutyl-N-[4-(2-fluorophenoxy)phenyl]imidazo[1,5-a]pyrazin-4-ium-4-amine |
| SMILES | Fc1ccccc1Oc1ccc(N(C2CCC2)[N+]23C=CN=CC2=CN=C3)cc1 |
| InChI | InChI=1S/C22H20FN4O/c23-21-6-1-2-7-22(21)28-20-10-8-18(9-11-20)26(17-4-3-5-17)27-13-12-24-14-19(27)15-25-16-27/h1-2,6-17H,3-5H2/q+1 |
| InChIKey | BKEGZZAIWBIYPA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|