C26H24N5O+ — CID 69304821
N-cyclobutyl-N-imidazo[1,5-a]pyrazin-4-ium-4-yl-4-methyl-2-phenoxyquinolin-7-amine (PubChem CID 69304821) has the molecular formula C26H24N5O+ and a molecular weight of 422.51 g/mol. Its IUPAC name is N-cyclobutyl-N-imidazo[1,5-a]pyrazin-4-ium-4-yl-4-methyl-2-phenoxyquinolin-7-amine.
| Compound Name | N-cyclobutyl-N-imidazo[1,5-a]pyrazin-4-ium-4-yl-4-methyl-2-phenoxyquinolin-7-amine |
|---|---|
| PubChem CID | 69304821 |
| Molecular Formula | C26H24N5O+ |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | N-cyclobutyl-N-imidazo[1,5-a]pyrazin-4-ium-4-yl-4-methyl-2-phenoxyquinolin-7-amine |
| SMILES | Cc1cc(Oc2ccccc2)nc2cc(N(C3CCC3)[N+]34C=CN=CC3=CN=C4)ccc12 |
| InChI | InChI=1S/C26H24N5O/c1-19-14-26(32-23-8-3-2-4-9-23)29-25-15-21(10-11-24(19)25)30(20-6-5-7-20)31-13-12-27-16-22(31)17-28-18-31/h2-4,8-18,20H,5-7H2,1H3/q+1 |
| InChIKey | JJOLMNAQGZLMDD-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|