C29H29N6OS+ — CID 123688947
4-[1-[imidazo[1,5-a]pyrazin-4-ium-4-yl-(2-phenylquinolin-7-yl)amino]cyclobutyl]morpholine-3-thiol (PubChem CID 123688947) has the molecular formula C29H29N6OS+ and a molecular weight of 509.66 g/mol. Its IUPAC name is 4-[1-[imidazo[1,5-a]pyrazin-4-ium-4-yl-(2-phenylquinolin-7-yl)amino]cyclobutyl]morpholine-3-thiol.
| Compound Name | 4-[1-[imidazo[1,5-a]pyrazin-4-ium-4-yl-(2-phenylquinolin-7-yl)amino]cyclobutyl]morpholine-3-thiol |
|---|---|
| PubChem CID | 123688947 |
| Molecular Formula | C29H29N6OS+ |
| Molecular Weight | 509.66 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | 4-[1-[imidazo[1,5-a]pyrazin-4-ium-4-yl-(2-phenylquinolin-7-yl)amino]cyclobutyl]morpholine-3-thiol |
| SMILES | SC1COCCN1C1(N(c2ccc3ccc(-c4ccccc4)nc3c2)[N+]23C=CN=CC2=CN=C3)CCC1 |
| InChI | InChI=1S/C29H28N6OS/c37-28-20-36-16-14-33(28)29(11-4-12-29)34(35-15-13-30-18-25(35)19-31-21-35)24-9-7-23-8-10-26(32-27(23)17-24)22-5-2-1-3-6-22/h1-3,5-10,13,15,17-19,21,28H,4,11-12,14,16,20H2/p+1 |
| InChIKey | CWXYZHGIZBRXHL-UHFFFAOYSA-O |
| XLogP | 5.35 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.66 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|