C30H31N6O+ — CID 91593029
1-N-imidazo[1,5-a]pyrazin-4-ium-4-yl-3-N-(oxan-4-yl)-1-N-(2-phenylquinolin-7-yl)cyclobutane-1,3-diamine (PubChem CID 91593029) has the molecular formula C30H31N6O+ and a molecular weight of 491.62 g/mol. Its IUPAC name is 1-N-imidazo[1,5-a]pyrazin-4-ium-4-yl-3-N-(oxan-4-yl)-1-N-(2-phenylquinolin-7-yl)cyclobutane-1,3-diamine.
| Compound Name | 1-N-imidazo[1,5-a]pyrazin-4-ium-4-yl-3-N-(oxan-4-yl)-1-N-(2-phenylquinolin-7-yl)cyclobutane-1,3-diamine |
|---|---|
| PubChem CID | 91593029 |
| Molecular Formula | C30H31N6O+ |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | 1-N-imidazo[1,5-a]pyrazin-4-ium-4-yl-3-N-(oxan-4-yl)-1-N-(2-phenylquinolin-7-yl)cyclobutane-1,3-diamine |
| SMILES | C1=C[N+]2(N(c3ccc4ccc(-c5ccccc5)nc4c3)C3CC(NC4CCOCC4)C3)C=NC=C2C=N1 |
| InChI | InChI=1S/C30H31N6O/c1-2-4-22(5-3-1)29-9-7-23-6-8-26(18-30(23)34-29)35(36-13-12-31-19-28(36)20-32-21-36)27-16-25(17-27)33-24-10-14-37-15-11-24/h1-9,12-13,18-21,24-25,27,33H,10-11,14-17H2/q+1 |
| InChIKey | HKVMUSBBPMEVSQ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|