C14H11IN4O2 — CID 90894747
4-[(1R,7R)-5-hydroxy-3-oxo-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-en-4-yl]-2-iodobenzonitrile (PubChem CID 90894747) has the molecular formula C14H11IN4O2 and a molecular weight of 394.17 g/mol. Its IUPAC name is 4-[(1R,7R)-5-hydroxy-3-oxo-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-en-4-yl]-2-iodobenzonitrile.
| Compound Name | 4-[(1R,7R)-5-hydroxy-3-oxo-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-en-4-yl]-2-iodobenzonitrile |
|---|---|
| PubChem CID | 90894747 |
| Molecular Formula | C14H11IN4O2 |
| Molecular Weight | 394.17 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | 4-[(1R,7R)-5-hydroxy-3-oxo-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-en-4-yl]-2-iodobenzonitrile |
| SMILES | N#Cc1ccc(-n2c(O)c3n(c2=O)[C@H]2CN[C@@H]3C2)cc1I |
| InChI | InChI=1S/C14H11IN4O2/c15-10-3-8(2-1-7(10)5-16)19-13(20)12-11-4-9(6-17-11)18(12)14(19)21/h1-3,9,11,17,20H,4,6H2/t9-,11-/m1/s1 |
| InChIKey | BCLVKGRXBGOLOE-MWLCHTKSSA-N |
| XLogP | 1.41 |
| TPSA | 82.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.17 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|