C16H12F3N3O3 — CID 90777854
4-[(1S,7R,9R)-5,9-dihydroxy-3-oxo-2,4-diazatricyclo[5.2.1.02,6]dec-5-en-4-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 90777854) has the molecular formula C16H12F3N3O3 and a molecular weight of 351.28 g/mol. Its IUPAC name is 4-[(1S,7R,9R)-5,9-dihydroxy-3-oxo-2,4-diazatricyclo[5.2.1.02,6]dec-5-en-4-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(1S,7R,9R)-5,9-dihydroxy-3-oxo-2,4-diazatricyclo[5.2.1.02,6]dec-5-en-4-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 90777854 |
| Molecular Formula | C16H12F3N3O3 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 4-[(1S,7R,9R)-5,9-dihydroxy-3-oxo-2,4-diazatricyclo[5.2.1.02,6]dec-5-en-4-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(-n2c(O)c3n(c2=O)[C@H]2C[C@@H]3C[C@H]2O)cc1C(F)(F)F |
| InChI | InChI=1S/C16H12F3N3O3/c17-16(18,19)10-5-9(2-1-7(10)6-20)21-14(24)13-8-3-11(12(23)4-8)22(13)15(21)25/h1-2,5,8,11-12,23-24H,3-4H2/t8-,11+,12-/m1/s1 |
| InChIKey | IHRNRPRMRQBHBF-JFUSQASVSA-N |
| XLogP | 2.03 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |