C23H20F3N3O5 — CID 91218953
tert-butyl [4-[1-[4-cyano-3-(trifluoromethyl)phenyl]-5-hydroxy-3-methyl-2-oxoimidazol-4-yl]phenyl] carbonate (PubChem CID 91218953) has the molecular formula C23H20F3N3O5 and a molecular weight of 475.42 g/mol. Its IUPAC name is tert-butyl [4-[1-[4-cyano-3-(trifluoromethyl)phenyl]-5-hydroxy-3-methyl-2-oxoimidazol-4-yl]phenyl] carbonate.
| Compound Name | tert-butyl [4-[1-[4-cyano-3-(trifluoromethyl)phenyl]-5-hydroxy-3-methyl-2-oxoimidazol-4-yl]phenyl] carbonate |
|---|---|
| PubChem CID | 91218953 |
| Molecular Formula | C23H20F3N3O5 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | tert-butyl [4-[1-[4-cyano-3-(trifluoromethyl)phenyl]-5-hydroxy-3-methyl-2-oxoimidazol-4-yl]phenyl] carbonate |
| SMILES | Cn1c(-c2ccc(OC(=O)OC(C)(C)C)cc2)c(O)n(-c2ccc(C#N)c(C(F)(F)F)c2)c1=O |
| InChI | InChI=1S/C23H20F3N3O5/c1-22(2,3)34-21(32)33-16-9-6-13(7-10-16)18-19(30)29(20(31)28(18)4)15-8-5-14(12-27)17(11-15)23(24,25)26/h5-11,30H,1-4H3 |
| InChIKey | CZUAGWKVVNAPCE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|