C17H13IN2O4 — CID 91377358
4-[(4R,7R)-1,3-dihydroxy-4,7-dimethyl-6-oxo-5H-4,7-epoxyisoindol-2-yl]-2-iodobenzonitrile (PubChem CID 91377358) has the molecular formula C17H13IN2O4 and a molecular weight of 436.21 g/mol. Its IUPAC name is 4-[(4R,7R)-1,3-dihydroxy-4,7-dimethyl-6-oxo-5H-4,7-epoxyisoindol-2-yl]-2-iodobenzonitrile.
| Compound Name | 4-[(4R,7R)-1,3-dihydroxy-4,7-dimethyl-6-oxo-5H-4,7-epoxyisoindol-2-yl]-2-iodobenzonitrile |
|---|---|
| PubChem CID | 91377358 |
| Molecular Formula | C17H13IN2O4 |
| Molecular Weight | 436.21 g/mol |
| Exact Mass | 435.99 |
| IUPAC Name | 4-[(4R,7R)-1,3-dihydroxy-4,7-dimethyl-6-oxo-5H-4,7-epoxyisoindol-2-yl]-2-iodobenzonitrile |
| SMILES | C[C@]12CC(=O)[C@](C)(O1)c1c2c(O)n(-c2ccc(C#N)c(I)c2)c1O |
| InChI | InChI=1S/C17H13IN2O4/c1-16-6-11(21)17(2,24-16)13-12(16)14(22)20(15(13)23)9-4-3-8(7-19)10(18)5-9/h3-5,22-23H,6H2,1-2H3/t16-,17+/m1/s1 |
| InChIKey | LJALQJAJSFNFIP-SJORKVTESA-N |
| XLogP | 2.80 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.21 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|