C17H13IN2O3 — CID 91090272
4-[(4S,7R)-1,3-dihydroxy-4,7-dimethyl-4,7-epoxyisoindol-2-yl]-2-iodobenzonitrile (PubChem CID 91090272) has the molecular formula C17H13IN2O3 and a molecular weight of 420.21 g/mol. Its IUPAC name is 4-[(4S,7R)-1,3-dihydroxy-4,7-dimethyl-4,7-epoxyisoindol-2-yl]-2-iodobenzonitrile.
| Compound Name | 4-[(4S,7R)-1,3-dihydroxy-4,7-dimethyl-4,7-epoxyisoindol-2-yl]-2-iodobenzonitrile |
|---|---|
| PubChem CID | 91090272 |
| Molecular Formula | C17H13IN2O3 |
| Molecular Weight | 420.21 g/mol |
| Exact Mass | 420.00 |
| IUPAC Name | 4-[(4S,7R)-1,3-dihydroxy-4,7-dimethyl-4,7-epoxyisoindol-2-yl]-2-iodobenzonitrile |
| SMILES | C[C@]12C=C[C@](C)(O1)c1c2c(O)n(-c2ccc(C#N)c(I)c2)c1O |
| InChI | InChI=1S/C17H13IN2O3/c1-16-5-6-17(2,23-16)13-12(16)14(21)20(15(13)22)10-4-3-9(8-19)11(18)7-10/h3-7,21-22H,1-2H3/t16-,17+ |
| InChIKey | GPANYGMTFIAJQG-CALCHBBNSA-N |
| XLogP | 3.40 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.21 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|