C33H26F3N3O9 — CID 90902754
(4aS,5aR,12aS)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-[4-[[4-(trifluoromethoxy)phenyl]carbamoylamino]phenyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90902754) has the molecular formula C33H26F3N3O9 and a molecular weight of 665.58 g/mol. Its IUPAC name is (4aS,5aR,12aS)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-[4-[[4-(trifluoromethoxy)phenyl]carbamoylamino]phenyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aS)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-[4-[[4-(trifluoromethoxy)phenyl]carbamoylamino]phenyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90902754 |
| Molecular Formula | C33H26F3N3O9 |
| Molecular Weight | 665.58 g/mol |
| Exact Mass | 665.16 |
| IUPAC Name | (4aS,5aR,12aS)-10,12a-dihydroxy-1,3,11,12-tetraoxo-7-[4-[[4-(trifluoromethoxy)phenyl]carbamoylamino]phenyl]-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | NC(=O)C1C(=O)C[C@@H]2C[C@@H]3Cc4c(-c5ccc(NC(=O)Nc6ccc(OC(F)(F)F)cc6)cc5)ccc(O)c4C(=O)C3C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C33H26F3N3O9/c34-33(35,36)48-19-7-5-18(6-8-19)39-31(46)38-17-3-1-14(2-4-17)20-9-10-22(40)25-21(20)12-15-11-16-13-23(41)26(30(37)45)29(44)32(16,47)28(43)24(15)27(25)42/h1-10,15-16,24,26,40,47H,11-13H2,(H2,37,45)(H2,38,39,46)/t15-,16+,24?,26?,32+/m1/s1 |
| InChIKey | XCKUHUQBXLPLHF-NRSFICAZSA-N |
| XLogP | 3.54 |
| TPSA | 202.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.58 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|