C14H11Br2NO4 — CID 90904073
2,3-dibromo-1-(4-methylphenyl)-3-(5-nitrofuran-2-yl)propan-1-one (PubChem CID 90904073) has the molecular formula C14H11Br2NO4 and a molecular weight of 417.05 g/mol. Its IUPAC name is 2,3-dibromo-1-(4-methylphenyl)-3-(5-nitrofuran-2-yl)propan-1-one.
| Compound Name | 2,3-dibromo-1-(4-methylphenyl)-3-(5-nitrofuran-2-yl)propan-1-one |
|---|---|
| PubChem CID | 90904073 |
| Molecular Formula | C14H11Br2NO4 |
| Molecular Weight | 417.05 g/mol |
| Exact Mass | 414.91 |
| IUPAC Name | 2,3-dibromo-1-(4-methylphenyl)-3-(5-nitrofuran-2-yl)propan-1-one |
| SMILES | Cc1ccc(C(=O)C(Br)C(Br)c2ccc([N+](=O)[O-])o2)cc1 |
| InChI | InChI=1S/C14H11Br2NO4/c1-8-2-4-9(5-3-8)14(18)13(16)12(15)10-6-7-11(21-10)17(19)20/h2-7,12-13H,1H3 |
| InChIKey | AWOVMRCYGKYDST-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 73.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.05 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|