C28H26FN3O8 — CID 90904241
(4S,4aS,5aR,12aS)-9-benzamido-4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 90904241) has the molecular formula C28H26FN3O8 and a molecular weight of 551.53 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-9-benzamido-4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-9-benzamido-4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 90904241 |
| Molecular Formula | C28H26FN3O8 |
| Molecular Weight | 551.53 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | (4S,4aS,5aR,12aS)-9-benzamido-4-(dimethylamino)-7-fluoro-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(O)c(NC(=O)c5ccccc5)cc(F)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C28H26FN3O8/c1-32(2)20-14-9-12-8-13-15(29)10-16(31-27(39)11-6-4-3-5-7-11)21(33)18(13)22(34)17(12)24(36)28(14,40)25(37)19(23(20)35)26(30)38/h3-7,10,12,14,17,19-20,33,40H,8-9H2,1-2H3,(H2,30,38)(H,31,39)/t12-,14-,17?,19?,20-,28-/m0/s1 |
| InChIKey | JSYGPMOBVSRUTI-GIEFNMACSA-N |
| XLogP | 0.26 |
| TPSA | 184.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.53 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|