C23H28N4O11S — CID 90905923
2-(2-amino-5-hydroxy-1,3-thiazol-4-yl)-N-[4-[2-[[1,1-dihydroxy-2-methoxy-2-(2,3,4,5-tetrahydroxy-6-methylphenyl)ethyl]amino]-2,2-dihydroxyethyl]phenyl]acetamide (PubChem CID 90905923) has the molecular formula C23H28N4O11S and a molecular weight of 568.56 g/mol. Its IUPAC name is 2-(2-amino-5-hydroxy-1,3-thiazol-4-yl)-N-[4-[2-[[1,1-dihydroxy-2-methoxy-2-(2,3,4,5-tetrahydroxy-6-methylphenyl)ethyl]amino]-2,2-dihydroxyethyl]phenyl]acetamide.
| Compound Name | 2-(2-amino-5-hydroxy-1,3-thiazol-4-yl)-N-[4-[2-[[1,1-dihydroxy-2-methoxy-2-(2,3,4,5-tetrahydroxy-6-methylphenyl)ethyl]amino]-2,2-dihydroxyethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 90905923 |
| Molecular Formula | C23H28N4O11S |
| Molecular Weight | 568.56 g/mol |
| Exact Mass | 568.15 |
| IUPAC Name | 2-(2-amino-5-hydroxy-1,3-thiazol-4-yl)-N-[4-[2-[[1,1-dihydroxy-2-methoxy-2-(2,3,4,5-tetrahydroxy-6-methylphenyl)ethyl]amino]-2,2-dihydroxyethyl]phenyl]acetamide |
| SMILES | COC(c1c(C)c(O)c(O)c(O)c1O)C(O)(O)NC(O)(O)Cc1ccc(NC(=O)Cc2nc(N)sc2O)cc1 |
| InChI | InChI=1S/C23H28N4O11S/c1-9-14(16(30)18(32)17(31)15(9)29)19(38-2)23(36,37)27-22(34,35)8-10-3-5-11(6-4-10)25-13(28)7-12-20(33)39-21(24)26-12/h3-6,19,27,29-37H,7-8H2,1-2H3,(H2,24,26)(H,25,28) |
| InChIKey | LXGMSKZBGSIFJJ-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 271.34 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.56 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|