C22H26N4O9S — CID 91355362
2-(2-amino-5-hydroxy-1,3-thiazol-4-yl)-N-[4-[2,2-dihydroxy-2-[(2-methoxy-2-phenylethyl)amino]ethyl]-2,3,5,6-tetrahydroxyphenyl]acetamide (PubChem CID 91355362) has the molecular formula C22H26N4O9S and a molecular weight of 522.54 g/mol. Its IUPAC name is 2-(2-amino-5-hydroxy-1,3-thiazol-4-yl)-N-[4-[2,2-dihydroxy-2-[(2-methoxy-2-phenylethyl)amino]ethyl]-2,3,5,6-tetrahydroxyphenyl]acetamide.
| Compound Name | 2-(2-amino-5-hydroxy-1,3-thiazol-4-yl)-N-[4-[2,2-dihydroxy-2-[(2-methoxy-2-phenylethyl)amino]ethyl]-2,3,5,6-tetrahydroxyphenyl]acetamide |
|---|---|
| PubChem CID | 91355362 |
| Molecular Formula | C22H26N4O9S |
| Molecular Weight | 522.54 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | 2-(2-amino-5-hydroxy-1,3-thiazol-4-yl)-N-[4-[2,2-dihydroxy-2-[(2-methoxy-2-phenylethyl)amino]ethyl]-2,3,5,6-tetrahydroxyphenyl]acetamide |
| SMILES | COC(CNC(O)(O)Cc1c(O)c(O)c(NC(=O)Cc2nc(N)sc2O)c(O)c1O)c1ccccc1 |
| InChI | InChI=1S/C22H26N4O9S/c1-35-13(10-5-3-2-4-6-10)9-24-22(33,34)8-11-16(28)18(30)15(19(31)17(11)29)26-14(27)7-12-20(32)36-21(23)25-12/h2-6,13,24,28-34H,7-9H2,1H3,(H2,23,25)(H,26,27) |
| InChIKey | AWAHQIMUFPJADV-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 230.88 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.54 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|