C21H24N4O13S — CID 91381757
2-(2-amino-5-hydroxy-1,3-thiazol-4-yl)-N-[4-[2-[[1,1-dihydroxy-2-(2,3,4,5,6-pentahydroxyphenyl)ethyl]amino]-2,2-dihydroxyethyl]phenyl]-2,2-dihydroxyacetamide (PubChem CID 91381757) has the molecular formula C21H24N4O13S and a molecular weight of 572.51 g/mol. Its IUPAC name is 2-(2-amino-5-hydroxy-1,3-thiazol-4-yl)-N-[4-[2-[[1,1-dihydroxy-2-(2,3,4,5,6-pentahydroxyphenyl)ethyl]amino]-2,2-dihydroxyethyl]phenyl]-2,2-dihydroxyacetamide.
| Compound Name | 2-(2-amino-5-hydroxy-1,3-thiazol-4-yl)-N-[4-[2-[[1,1-dihydroxy-2-(2,3,4,5,6-pentahydroxyphenyl)ethyl]amino]-2,2-dihydroxyethyl]phenyl]-2,2-dihydroxyacetamide |
|---|---|
| PubChem CID | 91381757 |
| Molecular Formula | C21H24N4O13S |
| Molecular Weight | 572.51 g/mol |
| Exact Mass | 572.11 |
| IUPAC Name | 2-(2-amino-5-hydroxy-1,3-thiazol-4-yl)-N-[4-[2-[[1,1-dihydroxy-2-(2,3,4,5,6-pentahydroxyphenyl)ethyl]amino]-2,2-dihydroxyethyl]phenyl]-2,2-dihydroxyacetamide |
| SMILES | Nc1nc(C(O)(O)C(=O)Nc2ccc(CC(O)(O)NC(O)(O)Cc3c(O)c(O)c(O)c(O)c3O)cc2)c(O)s1 |
| InChI | InChI=1S/C21H24N4O13S/c22-18-24-15(16(31)39-18)21(37,38)17(32)23-8-3-1-7(2-4-8)5-19(33,34)25-20(35,36)6-9-10(26)12(28)14(30)13(29)11(9)27/h1-4,25-31,33-38H,5-6H2,(H2,22,24)(H,23,32) |
| InChIKey | JRGRLMAJMZSINU-UHFFFAOYSA-N |
| XLogP | -2.61 |
| TPSA | 322.80 Ų |
| H-Bond Donors | 15 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.51 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 15 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|