C20H33N3O — CID 90906275
4-[[(6,8,8-trimethyl-4-oxononyl)amino]methyl]benzenecarboximidamide (PubChem CID 90906275) has the molecular formula C20H33N3O and a molecular weight of 331.50 g/mol. Its IUPAC name is 4-[[(6,8,8-trimethyl-4-oxononyl)amino]methyl]benzenecarboximidamide.
| Compound Name | 4-[[(6,8,8-trimethyl-4-oxononyl)amino]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 90906275 |
| Molecular Formula | C20H33N3O |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.26 |
| IUPAC Name | 4-[[(6,8,8-trimethyl-4-oxononyl)amino]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CNCCCC(=O)CC(C)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H33N3O/c1-15(13-20(2,3)4)12-18(24)6-5-11-23-14-16-7-9-17(10-8-16)19(21)22/h7-10,15,23H,5-6,11-14H2,1-4H3,(H3,21,22) |
| InChIKey | PAZOBVRPLKNVNZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|