C19H24O6 — CID 90906820
2-O-methyl 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] 3,4,5,6-tetramethylbicyclo[2.2.0]hexa-2,5-diene-1,2-dicarboxylate (PubChem CID 90906820) has the molecular formula C19H24O6 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-O-methyl 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] 3,4,5,6-tetramethylbicyclo[2.2.0]hexa-2,5-diene-1,2-dicarboxylate.
| Compound Name | 2-O-methyl 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] 3,4,5,6-tetramethylbicyclo[2.2.0]hexa-2,5-diene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 90906820 |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 2-O-methyl 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] 3,4,5,6-tetramethylbicyclo[2.2.0]hexa-2,5-diene-1,2-dicarboxylate |
| SMILES | C=C(C)C(=O)OCCOC(=O)C12C(C)=C(C)C1(C)C(C)=C2C(=O)OC |
| InChI | InChI=1S/C19H24O6/c1-10(2)15(20)24-8-9-25-17(22)19-12(4)11(3)18(19,6)13(5)14(19)16(21)23-7/h1,8-9H2,2-7H3 |
| InChIKey | HBMAYXJAVJZDMV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|