C17H25N — CID 90908001
6-but-2-enyl-2-methyl-2-propyl-3,4-dihydro-1H-quinoline (PubChem CID 90908001) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is 6-but-2-enyl-2-methyl-2-propyl-3,4-dihydro-1H-quinoline.
| Compound Name | 6-but-2-enyl-2-methyl-2-propyl-3,4-dihydro-1H-quinoline |
|---|---|
| PubChem CID | 90908001 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 6-but-2-enyl-2-methyl-2-propyl-3,4-dihydro-1H-quinoline |
| SMILES | CC=CCc1ccc2c(c1)CCC(C)(CCC)N2 |
| InChI | InChI=1S/C17H25N/c1-4-6-7-14-8-9-16-15(13-14)10-12-17(3,18-16)11-5-2/h4,6,8-9,13,18H,5,7,10-12H2,1-3H3 |
| InChIKey | SRKYDEPHYQYMOX-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|