C7H10N2O3S — CID 90909993
2-(2,5-dihydroxy-3-sulfanylpyrrol-1-yl)-N-methylacetamide (PubChem CID 90909993) has the molecular formula C7H10N2O3S and a molecular weight of 202.23 g/mol. Its IUPAC name is 2-(2,5-dihydroxy-3-sulfanylpyrrol-1-yl)-N-methylacetamide.
| Compound Name | 2-(2,5-dihydroxy-3-sulfanylpyrrol-1-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 90909993 |
| Molecular Formula | C7H10N2O3S |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 2-(2,5-dihydroxy-3-sulfanylpyrrol-1-yl)-N-methylacetamide |
| SMILES | CNC(=O)Cn1c(O)cc(S)c1O |
| InChI | InChI=1S/C7H10N2O3S/c1-8-5(10)3-9-6(11)2-4(13)7(9)12/h2,11-13H,3H2,1H3,(H,8,10) |
| InChIKey | CNYYXCQGQUGKBI-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|