C11H20N4O7 — CID 90910356
acetyl acetate;N-(2,5-dimethylpyrazol-3-yl)acetamide;N-hydroperoxyhydroxylamine (PubChem CID 90910356) has the molecular formula C11H20N4O7 and a molecular weight of 320.30 g/mol. Its IUPAC name is acetyl acetate;N-(2,5-dimethylpyrazol-3-yl)acetamide;N-hydroperoxyhydroxylamine.
| Compound Name | acetyl acetate;N-(2,5-dimethylpyrazol-3-yl)acetamide;N-hydroperoxyhydroxylamine |
|---|---|
| PubChem CID | 90910356 |
| Molecular Formula | C11H20N4O7 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | acetyl acetate;N-(2,5-dimethylpyrazol-3-yl)acetamide;N-hydroperoxyhydroxylamine |
| SMILES | CC(=O)Nc1cc(C)nn1C.CC(=O)OC(C)=O.ONOO |
| InChI | InChI=1S/C7H11N3O.C4H6O3.H3NO3/c1-5-4-7(8-6(2)11)10(3)9-5;1-3(5)7-4(2)6;2-1-4-3/h4H,1-3H3,(H,8,11);1-2H3;1-3H |
| InChIKey | MKLNPMSAAAXFQZ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 152.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|