C16H18N2 — CID 90910840
(3S)-4-methyl-3-phenyl-1,2,3,5-tetrahydro-1,4-benzodiazepine (PubChem CID 90910840) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is (3S)-4-methyl-3-phenyl-1,2,3,5-tetrahydro-1,4-benzodiazepine.
| Compound Name | (3S)-4-methyl-3-phenyl-1,2,3,5-tetrahydro-1,4-benzodiazepine |
|---|---|
| PubChem CID | 90910840 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | (3S)-4-methyl-3-phenyl-1,2,3,5-tetrahydro-1,4-benzodiazepine |
| SMILES | CN1Cc2ccccc2NC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H18N2/c1-18-12-14-9-5-6-10-15(14)17-11-16(18)13-7-3-2-4-8-13/h2-10,16-17H,11-12H2,1H3/t16-/m1/s1 |
| InChIKey | VLKDWNFAVNTNBQ-MRXNPFEDSA-N |
| XLogP | 3.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |