C19H17FN2O5 — CID 9091250
(E)-N-[(2-fluorophenyl)methyl]-N-methyl-3-(6-nitro-4H-1,3-benzodioxin-8-yl)prop-2-enamide (PubChem CID 9091250) has the molecular formula C19H17FN2O5 and a molecular weight of 372.35 g/mol. Its IUPAC name is (E)-N-[(2-fluorophenyl)methyl]-N-methyl-3-(6-nitro-4H-1,3-benzodioxin-8-yl)prop-2-enamide.
| Compound Name | (E)-N-[(2-fluorophenyl)methyl]-N-methyl-3-(6-nitro-4H-1,3-benzodioxin-8-yl)prop-2-enamide |
|---|---|
| PubChem CID | 9091250 |
| Molecular Formula | C19H17FN2O5 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | (E)-N-[(2-fluorophenyl)methyl]-N-methyl-3-(6-nitro-4H-1,3-benzodioxin-8-yl)prop-2-enamide |
| SMILES | CN(Cc1ccccc1F)C(=O)/C=C/c1cc([N+](=O)[O-])cc2c1OCOC2 |
| InChI | InChI=1S/C19H17FN2O5/c1-21(10-14-4-2-3-5-17(14)20)18(23)7-6-13-8-16(22(24)25)9-15-11-26-12-27-19(13)15/h2-9H,10-12H2,1H3/b7-6+ |
| InChIKey | ABDLIHAAGPDNSM-VOTSOKGWSA-N |
| XLogP | 3.27 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|