C19H23NO3 — CID 909139
2-[3-(3,4-dimethylanilino)prop-2-enoyl]-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 909139) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 2-[3-(3,4-dimethylanilino)prop-2-enoyl]-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-[3-(3,4-dimethylanilino)prop-2-enoyl]-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 909139 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 2-[3-(3,4-dimethylanilino)prop-2-enoyl]-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | Cc1ccc(NC=CC(=O)C2C(=O)CC(C)(C)CC2=O)cc1C |
| InChI | InChI=1S/C19H23NO3/c1-12-5-6-14(9-13(12)2)20-8-7-15(21)18-16(22)10-19(3,4)11-17(18)23/h5-9,18,20H,10-11H2,1-4H3 |
| InChIKey | KIGIMGJCAZILRU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|