C19H20N2O6S — CID 90914018
(2R)-2-[(4-cyanophenoxy)methyl]-3-(phenylmethoxycarbonylamino)propane-1-sulfonic acid (PubChem CID 90914018) has the molecular formula C19H20N2O6S and a molecular weight of 404.44 g/mol. Its IUPAC name is (2R)-2-[(4-cyanophenoxy)methyl]-3-(phenylmethoxycarbonylamino)propane-1-sulfonic acid.
| Compound Name | (2R)-2-[(4-cyanophenoxy)methyl]-3-(phenylmethoxycarbonylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 90914018 |
| Molecular Formula | C19H20N2O6S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | (2R)-2-[(4-cyanophenoxy)methyl]-3-(phenylmethoxycarbonylamino)propane-1-sulfonic acid |
| SMILES | N#Cc1ccc(OC[C@@H](CNC(=O)OCc2ccccc2)CS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C19H20N2O6S/c20-10-15-6-8-18(9-7-15)26-13-17(14-28(23,24)25)11-21-19(22)27-12-16-4-2-1-3-5-16/h1-9,17H,11-14H2,(H,21,22)(H,23,24,25)/t17-/m1/s1 |
| InChIKey | HDKZCAILQJLODU-QGZVFWFLSA-N |
| XLogP | 2.37 |
| TPSA | 125.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|