C20H22N2O5 — CID 171856624
benzyl N-[3-[4-(2-cyanoethoxy)phenyl]-2,3-dihydroxypropyl]carbamate (PubChem CID 171856624) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is benzyl N-[3-[4-(2-cyanoethoxy)phenyl]-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-[4-(2-cyanoethoxy)phenyl]-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171856624 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | benzyl N-[3-[4-(2-cyanoethoxy)phenyl]-2,3-dihydroxypropyl]carbamate |
| SMILES | N#CCCOc1ccc(C(O)C(O)CNC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H22N2O5/c21-11-4-12-26-17-9-7-16(8-10-17)19(24)18(23)13-22-20(25)27-14-15-5-2-1-3-6-15/h1-3,5-10,18-19,23-24H,4,12-14H2,(H,22,25) |
| InChIKey | WCDCYBDKGLTFDD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 111.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|