C18H17ClN2O4 — CID 171855951
benzyl N-[3-(3-chloro-5-cyanophenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 171855951) has the molecular formula C18H17ClN2O4 and a molecular weight of 360.80 g/mol. Its IUPAC name is benzyl N-[3-(3-chloro-5-cyanophenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | benzyl N-[3-(3-chloro-5-cyanophenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 171855951 |
| Molecular Formula | C18H17ClN2O4 |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | benzyl N-[3-(3-chloro-5-cyanophenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | N#Cc1cc(Cl)cc(C(O)C(O)CNC(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C18H17ClN2O4/c19-15-7-13(9-20)6-14(8-15)17(23)16(22)10-21-18(24)25-11-12-4-2-1-3-5-12/h1-8,16-17,22-23H,10-11H2,(H,21,24) |
| InChIKey | BYEKCSRPSMJXHV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |