C24H26N2O5 — CID 90919315
8-[3-[2-(diethylamino)ethoxy]phenyl]-5,12,14-trioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),2,9,11(15)-tetraen-6-one (PubChem CID 90919315) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is 8-[3-[2-(diethylamino)ethoxy]phenyl]-5,12,14-trioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),2,9,11(15)-tetraen-6-one.
| Compound Name | 8-[3-[2-(diethylamino)ethoxy]phenyl]-5,12,14-trioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),2,9,11(15)-tetraen-6-one |
|---|---|
| PubChem CID | 90919315 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 8-[3-[2-(diethylamino)ethoxy]phenyl]-5,12,14-trioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),2,9,11(15)-tetraen-6-one |
| SMILES | CCN(CC)CCOc1cccc(C2c3cc4c(cc3N=C3COC(=O)C32)OCO4)c1 |
| InChI | InChI=1S/C24H26N2O5/c1-3-26(4-2)8-9-28-16-7-5-6-15(10-16)22-17-11-20-21(31-14-30-20)12-18(17)25-19-13-29-24(27)23(19)22/h5-7,10-12,22-23H,3-4,8-9,13-14H2,1-2H3 |
| InChIKey | KLNABGKYTBRFQD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 69.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |