C13H9BrO5S — CID 90921265
(2-bromo-3,6-dioxocyclohexa-1,4-dien-1-yl) 4-methylbenzenesulfonate (PubChem CID 90921265) has the molecular formula C13H9BrO5S and a molecular weight of 357.18 g/mol. Its IUPAC name is (2-bromo-3,6-dioxocyclohexa-1,4-dien-1-yl) 4-methylbenzenesulfonate.
| Compound Name | (2-bromo-3,6-dioxocyclohexa-1,4-dien-1-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 90921265 |
| Molecular Formula | C13H9BrO5S |
| Molecular Weight | 357.18 g/mol |
| Exact Mass | 355.94 |
| IUPAC Name | (2-bromo-3,6-dioxocyclohexa-1,4-dien-1-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2=C(Br)C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C13H9BrO5S/c1-8-2-4-9(5-3-8)20(17,18)19-13-11(16)7-6-10(15)12(13)14/h2-7H,1H3 |
| InChIKey | DJUPESUTRALCKU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.18 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|