C19H32O — CID 90927569
6-ethylnona-2,4,6-trien-5-yloxymethylcycloheptane (PubChem CID 90927569) has the molecular formula C19H32O and a molecular weight of 276.46 g/mol. Its IUPAC name is 6-ethylnona-2,4,6-trien-5-yloxymethylcycloheptane.
| Compound Name | 6-ethylnona-2,4,6-trien-5-yloxymethylcycloheptane |
|---|---|
| PubChem CID | 90927569 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | 6-ethylnona-2,4,6-trien-5-yloxymethylcycloheptane |
| SMILES | CC=CC=C(OCC1CCCCCC1)C(=CCC)CC |
| InChI | InChI=1S/C19H32O/c1-4-7-15-19(18(6-3)12-5-2)20-16-17-13-10-8-9-11-14-17/h4,7,12,15,17H,5-6,8-11,13-14,16H2,1-3H3 |
| InChIKey | FNYAHSRQFJUZAK-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|