C27H22N2O6S — CID 90934101
dibenzamido 2-(1-benzothiophen-2-ylmethyl)-2-methylpropanedioate (PubChem CID 90934101) has the molecular formula C27H22N2O6S and a molecular weight of 502.55 g/mol. Its IUPAC name is dibenzamido 2-(1-benzothiophen-2-ylmethyl)-2-methylpropanedioate.
| Compound Name | dibenzamido 2-(1-benzothiophen-2-ylmethyl)-2-methylpropanedioate |
|---|---|
| PubChem CID | 90934101 |
| Molecular Formula | C27H22N2O6S |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | dibenzamido 2-(1-benzothiophen-2-ylmethyl)-2-methylpropanedioate |
| SMILES | CC(Cc1cc2ccccc2s1)(C(=O)ONC(=O)c1ccccc1)C(=O)ONC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H22N2O6S/c1-27(17-21-16-20-14-8-9-15-22(20)36-21,25(32)34-28-23(30)18-10-4-2-5-11-18)26(33)35-29-24(31)19-12-6-3-7-13-19/h2-16H,17H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | JMARBWKNYKXATM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|