C14H28O2 — CID 90935262
5-ethoxy-3-methoxy-2,2,6,6-tetramethylhept-3-ene (PubChem CID 90935262) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is 5-ethoxy-3-methoxy-2,2,6,6-tetramethylhept-3-ene.
| Compound Name | 5-ethoxy-3-methoxy-2,2,6,6-tetramethylhept-3-ene |
|---|---|
| PubChem CID | 90935262 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 5-ethoxy-3-methoxy-2,2,6,6-tetramethylhept-3-ene |
| SMILES | CCOC(C=C(OC)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H28O2/c1-9-16-12(14(5,6)7)10-11(15-8)13(2,3)4/h10,12H,9H2,1-8H3 |
| InChIKey | VFWUKMLMMGQHFD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|