C12H17F7O2 — CID 90936357
(Z)-1,1,1,2,2,3,3-heptafluoro-4,6-dimethoxy-7,7-dimethyloct-4-ene (PubChem CID 90936357) has the molecular formula C12H17F7O2 and a molecular weight of 326.25 g/mol. Its IUPAC name is (Z)-1,1,1,2,2,3,3-heptafluoro-4,6-dimethoxy-7,7-dimethyloct-4-ene.
| Compound Name | (Z)-1,1,1,2,2,3,3-heptafluoro-4,6-dimethoxy-7,7-dimethyloct-4-ene |
|---|---|
| PubChem CID | 90936357 |
| Molecular Formula | C12H17F7O2 |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | (Z)-1,1,1,2,2,3,3-heptafluoro-4,6-dimethoxy-7,7-dimethyloct-4-ene |
| SMILES | CO/C(=C\C(OC)C(C)(C)C)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H17F7O2/c1-9(2,3)7(20-4)6-8(21-5)10(13,14)11(15,16)12(17,18)19/h6-7H,1-5H3/b8-6- |
| InChIKey | ICVRYXLPZBWWMU-VURMDHGXSA-N |
| XLogP | 4.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|