C12H20O6 — CID 90936292
1-[(4S,5R,6S)-4,5-dihydroxy-2,2-dimethyl-1,7-dioxaspiro[2.4]heptan-6-yl]-2-hydroxy-3-methylbutan-1-one (PubChem CID 90936292) has the molecular formula C12H20O6 and a molecular weight of 260.29 g/mol. Its IUPAC name is 1-[(4S,5R,6S)-4,5-dihydroxy-2,2-dimethyl-1,7-dioxaspiro[2.4]heptan-6-yl]-2-hydroxy-3-methylbutan-1-one.
| Compound Name | 1-[(4S,5R,6S)-4,5-dihydroxy-2,2-dimethyl-1,7-dioxaspiro[2.4]heptan-6-yl]-2-hydroxy-3-methylbutan-1-one |
|---|---|
| PubChem CID | 90936292 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 1-[(4S,5R,6S)-4,5-dihydroxy-2,2-dimethyl-1,7-dioxaspiro[2.4]heptan-6-yl]-2-hydroxy-3-methylbutan-1-one |
| SMILES | CC(C)C(O)C(=O)[C@H]1OC2(OC2(C)C)C(O)[C@H]1O |
| InChI | InChI=1S/C12H20O6/c1-5(2)6(13)7(14)9-8(15)10(16)12(17-9)11(3,4)18-12/h5-6,8-10,13,15-16H,1-4H3/t6?,8-,9+,10?,12?/m0/s1 |
| InChIKey | FNARACQAPPSFLO-HRUODYRGSA-N |
| XLogP | -0.80 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|