C12H18N4 — CID 90936477
N,N'-bis(2,3,4,5-tetrahydropyridin-6-yl)ethyne-1,2-diamine (PubChem CID 90936477) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is N,N'-bis(2,3,4,5-tetrahydropyridin-6-yl)ethyne-1,2-diamine.
| Compound Name | N,N'-bis(2,3,4,5-tetrahydropyridin-6-yl)ethyne-1,2-diamine |
|---|---|
| PubChem CID | 90936477 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | N,N'-bis(2,3,4,5-tetrahydropyridin-6-yl)ethyne-1,2-diamine |
| SMILES | C(#CNC1=NCCCC1)NC1=NCCCC1 |
| InChI | InChI=1S/C12H18N4/c1-3-7-13-11(5-1)15-9-10-16-12-6-2-4-8-14-12/h1-8H2,(H,13,15)(H,14,16) |
| InChIKey | YDRVEMXZANJGPI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|