C20H26N2OS — CID 90937747
5-(2-cyclopropylethyl)-2,2-diethyl-2'-sulfanylidenespiro[1H-indene-3,5'-imidazolidine]-4'-one (PubChem CID 90937747) has the molecular formula C20H26N2OS and a molecular weight of 342.51 g/mol. Its IUPAC name is 5-(2-cyclopropylethyl)-2,2-diethyl-2'-sulfanylidenespiro[1H-indene-3,5'-imidazolidine]-4'-one.
| Compound Name | 5-(2-cyclopropylethyl)-2,2-diethyl-2'-sulfanylidenespiro[1H-indene-3,5'-imidazolidine]-4'-one |
|---|---|
| PubChem CID | 90937747 |
| Molecular Formula | C20H26N2OS |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 5-(2-cyclopropylethyl)-2,2-diethyl-2'-sulfanylidenespiro[1H-indene-3,5'-imidazolidine]-4'-one |
| SMILES | CCC1(CC)Cc2ccc(CCC3CC3)cc2C12NC(=S)NC2=O |
| InChI | InChI=1S/C20H26N2OS/c1-3-19(4-2)12-15-10-9-14(8-7-13-5-6-13)11-16(15)20(19)17(23)21-18(24)22-20/h9-11,13H,3-8,12H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | KJKZWAHXGIZGKO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|