C12H9ClF3N3O4S — CID 90937958
N-chloro-3-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzenesulfonamide (PubChem CID 90937958) has the molecular formula C12H9ClF3N3O4S and a molecular weight of 383.74 g/mol. Its IUPAC name is N-chloro-3-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzenesulfonamide.
| Compound Name | N-chloro-3-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 90937958 |
| Molecular Formula | C12H9ClF3N3O4S |
| Molecular Weight | 383.74 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | N-chloro-3-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzenesulfonamide |
| SMILES | Cn1c(C(F)(F)F)cc(=O)n(-c2cccc(S(=O)(=O)NCl)c2)c1=O |
| InChI | InChI=1S/C12H9ClF3N3O4S/c1-18-9(12(14,15)16)6-10(20)19(11(18)21)7-3-2-4-8(5-7)24(22,23)17-13/h2-6,17H,1H3 |
| InChIKey | VSPAVWYBGWBAIV-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.74 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|