C26H29NO4S2 — CID 90938552
ethyl (4R,5S)-5-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidine-3-carbonyl]-4-hydroxy-7-phenylhept-2-enoate (PubChem CID 90938552) has the molecular formula C26H29NO4S2 and a molecular weight of 483.66 g/mol. Its IUPAC name is ethyl (4R,5S)-5-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidine-3-carbonyl]-4-hydroxy-7-phenylhept-2-enoate.
| Compound Name | ethyl (4R,5S)-5-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidine-3-carbonyl]-4-hydroxy-7-phenylhept-2-enoate |
|---|---|
| PubChem CID | 90938552 |
| Molecular Formula | C26H29NO4S2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | ethyl (4R,5S)-5-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidine-3-carbonyl]-4-hydroxy-7-phenylhept-2-enoate |
| SMILES | CCOC(=O)C=C[C@@H](O)[C@H](CCc1ccccc1)C(=O)N1C(=S)SC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C26H29NO4S2/c1-2-31-24(29)16-15-23(28)22(14-13-19-9-5-3-6-10-19)25(30)27-21(18-33-26(27)32)17-20-11-7-4-8-12-20/h3-12,15-16,21-23,28H,2,13-14,17-18H2,1H3/t21-,22-,23+/m0/s1 |
| InChIKey | MWIJSFGBSBQXGS-RJGXRXQPSA-N |
| XLogP | 4.19 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|