C24H25NO3S2 — CID 135024041
[(E,3S,4S)-5-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methyl-5-oxo-1-phenylpent-1-en-3-yl] acetate (PubChem CID 135024041) has the molecular formula C24H25NO3S2 and a molecular weight of 439.60 g/mol. Its IUPAC name is [(E,3S,4S)-5-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methyl-5-oxo-1-phenylpent-1-en-3-yl] acetate.
| Compound Name | [(E,3S,4S)-5-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methyl-5-oxo-1-phenylpent-1-en-3-yl] acetate |
|---|---|
| PubChem CID | 135024041 |
| Molecular Formula | C24H25NO3S2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | [(E,3S,4S)-5-[(4S)-4-benzyl-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methyl-5-oxo-1-phenylpent-1-en-3-yl] acetate |
| SMILES | CC(=O)O[C@@H](/C=C/c1ccccc1)[C@H](C)C(=O)N1C(=S)SC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C24H25NO3S2/c1-17(22(28-18(2)26)14-13-19-9-5-3-6-10-19)23(27)25-21(16-30-24(25)29)15-20-11-7-4-8-12-20/h3-14,17,21-22H,15-16H2,1-2H3/b14-13+/t17-,21-,22-/m0/s1 |
| InChIKey | PAHYOVDLRBXHMN-RROVGAOMSA-N |
| XLogP | 4.74 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|