C12H2F10O7P2S — CID 90939737
[hydroperoxy-(2,3,4,5,6-pentafluorophenoxy)phosphinothioyl] (2,3,4,5,6-pentafluorophenyl) hydrogen phosphate (PubChem CID 90939737) has the molecular formula C12H2F10O7P2S and a molecular weight of 542.14 g/mol. Its IUPAC name is [hydroperoxy-(2,3,4,5,6-pentafluorophenoxy)phosphinothioyl] (2,3,4,5,6-pentafluorophenyl) hydrogen phosphate.
| Compound Name | [hydroperoxy-(2,3,4,5,6-pentafluorophenoxy)phosphinothioyl] (2,3,4,5,6-pentafluorophenyl) hydrogen phosphate |
|---|---|
| PubChem CID | 90939737 |
| Molecular Formula | C12H2F10O7P2S |
| Molecular Weight | 542.14 g/mol |
| Exact Mass | 541.88 |
| IUPAC Name | [hydroperoxy-(2,3,4,5,6-pentafluorophenoxy)phosphinothioyl] (2,3,4,5,6-pentafluorophenyl) hydrogen phosphate |
| SMILES | O=P(O)(Oc1c(F)c(F)c(F)c(F)c1F)OP(=S)(OO)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H2F10O7P2S/c13-1-3(15)7(19)11(8(20)4(1)16)26-30(24,25)29-31(32,28-23)27-12-9(21)5(17)2(14)6(18)10(12)22/h23H,(H,24,25) |
| InChIKey | NECBUDHTWFKSPU-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.14 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|