C6H3F5O6P2S — CID 91260360
[hydroxy-(2,3,4,5,6-pentafluorophenoxy)phosphinothioyl] dihydrogen phosphate (PubChem CID 91260360) has the molecular formula C6H3F5O6P2S and a molecular weight of 360.09 g/mol. Its IUPAC name is [hydroxy-(2,3,4,5,6-pentafluorophenoxy)phosphinothioyl] dihydrogen phosphate.
| Compound Name | [hydroxy-(2,3,4,5,6-pentafluorophenoxy)phosphinothioyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 91260360 |
| Molecular Formula | C6H3F5O6P2S |
| Molecular Weight | 360.09 g/mol |
| Exact Mass | 359.90 |
| IUPAC Name | [hydroxy-(2,3,4,5,6-pentafluorophenoxy)phosphinothioyl] dihydrogen phosphate |
| SMILES | O=P(O)(O)OP(O)(=S)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C6H3F5O6P2S/c7-1-2(8)4(10)6(5(11)3(1)9)16-19(15,20)17-18(12,13)14/h(H,15,20)(H2,12,13,14) |
| InChIKey | KIWXREXKKFDFHF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.09 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|