C9H8F2O2 — CID 90939794
2-(difluoromethyl)-3,6-dimethylidenecyclohexa-1,4-diene-1,4-diol (PubChem CID 90939794) has the molecular formula C9H8F2O2 and a molecular weight of 186.16 g/mol. Its IUPAC name is 2-(difluoromethyl)-3,6-dimethylidenecyclohexa-1,4-diene-1,4-diol.
| Compound Name | 2-(difluoromethyl)-3,6-dimethylidenecyclohexa-1,4-diene-1,4-diol |
|---|---|
| PubChem CID | 90939794 |
| Molecular Formula | C9H8F2O2 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 2-(difluoromethyl)-3,6-dimethylidenecyclohexa-1,4-diene-1,4-diol |
| SMILES | C=c1cc(O)c(=C)c(C(F)F)c1O |
| InChI | InChI=1S/C9H8F2O2/c1-4-3-6(12)5(2)7(8(4)13)9(10)11/h3,9,12-13H,1-2H2 |
| InChIKey | KDOFLMYEURDJSE-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|