C11H11F3O — CID 147549097
(1Z)-1-[3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]buta-1,3-dien-1-ol (PubChem CID 147549097) has the molecular formula C11H11F3O and a molecular weight of 216.20 g/mol. Its IUPAC name is (1Z)-1-[3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]buta-1,3-dien-1-ol.
| Compound Name | (1Z)-1-[3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]buta-1,3-dien-1-ol |
|---|---|
| PubChem CID | 147549097 |
| Molecular Formula | C11H11F3O |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | (1Z)-1-[3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]buta-1,3-dien-1-ol |
| SMILES | C=C/C=C(\O)C1=CC(C(F)(F)F)CC=C1 |
| InChI | InChI=1S/C11H11F3O/c1-2-4-10(15)8-5-3-6-9(7-8)11(12,13)14/h2-5,7,9,15H,1,6H2/b10-4- |
| InChIKey | FQKNUKUEWSHNGW-WMZJFQQLSA-N |
| XLogP | 3.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|