C9H8F6O2 — CID 175099247
4-(1,2,2,3,3,3-hexafluoropropyl)cyclohexa-2,4-diene-1,1-diol (PubChem CID 175099247) has the molecular formula C9H8F6O2 and a molecular weight of 262.15 g/mol. Its IUPAC name is 4-(1,2,2,3,3,3-hexafluoropropyl)cyclohexa-2,4-diene-1,1-diol.
| Compound Name | 4-(1,2,2,3,3,3-hexafluoropropyl)cyclohexa-2,4-diene-1,1-diol |
|---|---|
| PubChem CID | 175099247 |
| Molecular Formula | C9H8F6O2 |
| Molecular Weight | 262.15 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 4-(1,2,2,3,3,3-hexafluoropropyl)cyclohexa-2,4-diene-1,1-diol |
| SMILES | OC1(O)C=CC(C(F)C(F)(F)C(F)(F)F)=CC1 |
| InChI | InChI=1S/C9H8F6O2/c10-6(8(11,12)9(13,14)15)5-1-3-7(16,17)4-2-5/h1-3,6,16-17H,4H2 |
| InChIKey | XUYFBLFBAUNXLH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.15 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|