C44H38N4O5S2 — CID 90941552
2-[3,6-dihydroxy-4,5-bis[[pyridin-2-ylmethyl(thiophen-2-ylmethyl)amino]methyl]-9H-xanthen-9-yl]benzoic acid (PubChem CID 90941552) has the molecular formula C44H38N4O5S2 and a molecular weight of 766.95 g/mol. Its IUPAC name is 2-[3,6-dihydroxy-4,5-bis[[pyridin-2-ylmethyl(thiophen-2-ylmethyl)amino]methyl]-9H-xanthen-9-yl]benzoic acid.
| Compound Name | 2-[3,6-dihydroxy-4,5-bis[[pyridin-2-ylmethyl(thiophen-2-ylmethyl)amino]methyl]-9H-xanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 90941552 |
| Molecular Formula | C44H38N4O5S2 |
| Molecular Weight | 766.95 g/mol |
| Exact Mass | 766.23 |
| IUPAC Name | 2-[3,6-dihydroxy-4,5-bis[[pyridin-2-ylmethyl(thiophen-2-ylmethyl)amino]methyl]-9H-xanthen-9-yl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C1c2ccc(O)c(CN(Cc3ccccn3)Cc3cccs3)c2Oc2c1ccc(O)c2CN(Cc1ccccn1)Cc1cccs1 |
| InChI | InChI=1S/C44H38N4O5S2/c49-39-17-15-35-41(33-13-1-2-14-34(33)44(51)52)36-16-18-40(50)38(28-48(26-32-12-8-22-55-32)24-30-10-4-6-20-46-30)43(36)53-42(35)37(39)27-47(25-31-11-7-21-54-31)23-29-9-3-5-19-45-29/h1-22,41,49-50H,23-28H2,(H,51,52) |
| InChIKey | YZZXHSHNFWAFMD-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.95 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|