C14H22N2O5S — CID 90942700
(2S)-2-[[(2S)-4-(2,5-dihydroxypyrrol-1-yl)-2-sulfanylbutanoyl]amino]-4-methylpentanoic acid (PubChem CID 90942700) has the molecular formula C14H22N2O5S and a molecular weight of 330.41 g/mol. Its IUPAC name is (2S)-2-[[(2S)-4-(2,5-dihydroxypyrrol-1-yl)-2-sulfanylbutanoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(2S)-4-(2,5-dihydroxypyrrol-1-yl)-2-sulfanylbutanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 90942700 |
| Molecular Formula | C14H22N2O5S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (2S)-2-[[(2S)-4-(2,5-dihydroxypyrrol-1-yl)-2-sulfanylbutanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](S)CCn1c(O)ccc1O)C(=O)O |
| InChI | InChI=1S/C14H22N2O5S/c1-8(2)7-9(14(20)21)15-13(19)10(22)5-6-16-11(17)3-4-12(16)18/h3-4,8-10,17-18,22H,5-7H2,1-2H3,(H,15,19)(H,20,21)/t9-,10-/m0/s1 |
| InChIKey | NFAPEFJFBJGLRE-UWVGGRQHSA-N |
| XLogP | 1.20 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|